C20H17Br2NO4 — CID 27307308
(5,7-dibromoquinolin-8-yl) (1S,4S)-4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 27307308) has the molecular formula C20H17Br2NO4 and a molecular weight of 495.17 g/mol. Its IUPAC name is (5,7-dibromoquinolin-8-yl) (1S,4S)-4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | (5,7-dibromoquinolin-8-yl) (1S,4S)-4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 27307308 |
| Molecular Formula | C20H17Br2NO4 |
| Molecular Weight | 495.17 g/mol |
| Exact Mass | 492.95 |
| IUPAC Name | (5,7-dibromoquinolin-8-yl) (1S,4S)-4,7,7-trimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)[C@@]2(C(=O)Oc3c(Br)cc(Br)c4cccnc34)CC[C@]1(C)C(=O)C2=O |
| InChI | InChI=1S/C20H17Br2NO4/c1-18(2)19(3)6-7-20(18,16(25)15(19)24)17(26)27-14-12(22)9-11(21)10-5-4-8-23-13(10)14/h4-5,8-9H,6-7H2,1-3H3/t19-,20+/m1/s1 |
| InChIKey | URUNJFKMGKZHIQ-UXHICEINSA-N |
| XLogP | 4.63 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.17 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|