About N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide
N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide (PubChem CID 2730766) has the molecular formula C14H12F6N6O2
and a molecular weight of 410.28 g/mol. Its IUPAC name is N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide.
Molecular Properties
| Compound Name | N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide |
| PubChem CID | 2730766 |
| Molecular Formula | C14H12F6N6O2 |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide |
| SMILES | CC(=O)NNC(=O)C(C)n1nnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H12F6N6O2/c1-6(12(28)23-21-7(2)27)26-24-11(22-25-26)8-3-9(13(15,16)17)5-10(4-8)14(18,19)20/h3-6H,1-2H3,(H,21,27)(H,23,28) |
| InChIKey | XICBXBZSQRIRCW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide?
The IUPAC name of N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide (CID 2730766) is N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide.
What is the SMILES notation for N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide?
The canonical SMILES for N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide is CC(=O)NNC(=O)C(C)n1nnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1.
What is the InChIKey of N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide?
The InChIKey is XICBXBZSQRIRCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F6N6O2/c1-6(12(28)23-21-7(2)27)26-24-11(22-25-26)8-3-9(13(15,16)17)5-10(4-8)14(18,19)20/h3-6H,1-2H3,(H,21,27)(H,23,28).
What are the key properties of N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide?
N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide has a molecular weight of 410.28 g/mol, XLogP of 2.11, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-acetyl-2-[5-[3,5-bis(trifluoromethyl)phenyl]tetrazol-2-yl]propanehydrazide is sourced from PubChem (CID 2730766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).