C24H19F2N3O3 — CID 27307962
(1R,1aR)-2-[4-(difluoromethoxy)phenyl]-5,6-dimethyl-1-(4-nitrophenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline (PubChem CID 27307962) has the molecular formula C24H19F2N3O3 and a molecular weight of 435.43 g/mol. Its IUPAC name is (1R,1aR)-2-[4-(difluoromethoxy)phenyl]-5,6-dimethyl-1-(4-nitrophenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline.
| Compound Name | (1R,1aR)-2-[4-(difluoromethoxy)phenyl]-5,6-dimethyl-1-(4-nitrophenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 27307962 |
| Molecular Formula | C24H19F2N3O3 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (1R,1aR)-2-[4-(difluoromethoxy)phenyl]-5,6-dimethyl-1-(4-nitrophenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline |
| SMILES | Cc1cc2c(cc1C)N1[C@H](c3ccc([N+](=O)[O-])cc3)[C@@H]1C(c1ccc(OC(F)F)cc1)=N2 |
| InChI | InChI=1S/C24H19F2N3O3/c1-13-11-19-20(12-14(13)2)28-22(16-3-7-17(8-4-16)29(30)31)23(28)21(27-19)15-5-9-18(10-6-15)32-24(25)26/h3-12,22-24H,1-2H3/t22-,23+,28?/m1/s1 |
| InChIKey | PKCRTIILKUFSJZ-UNFSCDGZSA-N |
| XLogP | 5.88 |
| TPSA | 67.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|