C21H26NO+ — CID 27308
trimethyl-[2-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyloxy)ethyl]azanium (PubChem CID 27308) has the molecular formula C21H26NO+ and a molecular weight of 308.45 g/mol. Its IUPAC name is trimethyl-[2-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyloxy)ethyl]azanium.
| Compound Name | trimethyl-[2-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 27308 |
| Molecular Formula | C21H26NO+ |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | trimethyl-[2-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyloxy)ethyl]azanium |
| SMILES | C[N+](C)(C)CCOC12CCC(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C21H26NO/c1-22(2,3)14-15-23-21-13-12-16(17-8-4-6-10-19(17)21)18-9-5-7-11-20(18)21/h4-11,16H,12-15H2,1-3H3/q+1 |
| InChIKey | BAKPLKDDHJPEKS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|