About N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine
N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine (PubChem CID 27309079) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine.
Molecular Properties
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine |
| PubChem CID | 27309079 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine |
| SMILES | Cc1ccc(/C=N/[C@H]2CCS(=O)(=O)C2)o1 |
| InChI | InChI=1S/C10H13NO3S/c1-8-2-3-10(14-8)6-11-9-4-5-15(12,13)7-9/h2-3,6,9H,4-5,7H2,1H3/b11-6+/t9-/m0/s1 |
| InChIKey | YMSREWLMBPGPBJ-CAXXOGMASA-N |
| XLogP | 1.19 |
| TPSA | 59.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine?
The IUPAC name of N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine (CID 27309079) is N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine.
What is the SMILES notation for N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine?
The canonical SMILES for N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine is Cc1ccc(/C=N/[C@H]2CCS(=O)(=O)C2)o1.
What is the InChIKey of N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine?
The InChIKey is YMSREWLMBPGPBJ-CAXXOGMASA-N. The full InChI is InChI=1S/C10H13NO3S/c1-8-2-3-10(14-8)6-11-9-4-5-15(12,13)7-9/h2-3,6,9H,4-5,7H2,1H3/b11-6+/t9-/m0/s1.
What are the key properties of N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine?
N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine has a molecular weight of 227.28 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-1,1-dioxothiolan-3-yl]-1-(5-methylfuran-2-yl)methanimine is sourced from PubChem (CID 27309079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).