About 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea
1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea (PubChem CID 2731037) has the molecular formula C11H16N2OS
and a molecular weight of 224.33 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea.
Molecular Properties
| Compound Name | 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea |
| PubChem CID | 2731037 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCCO)cc1C |
| InChI | InChI=1S/C11H16N2OS/c1-8-3-4-10(7-9(8)2)13-11(15)12-5-6-14/h3-4,7,14H,5-6H2,1-2H3,(H2,12,13,15) |
| InChIKey | DQXAWIJZQJGVHS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea?
The IUPAC name of 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea (CID 2731037) is 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea.
What is the SMILES notation for 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea?
The canonical SMILES for 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea is Cc1ccc(NC(=S)NCCO)cc1C.
What is the InChIKey of 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea?
The InChIKey is DQXAWIJZQJGVHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2OS/c1-8-3-4-10(7-9(8)2)13-11(15)12-5-6-14/h3-4,7,14H,5-6H2,1-2H3,(H2,12,13,15).
What are the key properties of 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea?
1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea has a molecular weight of 224.33 g/mol, XLogP of 1.58, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylphenyl)-3-(2-hydroxyethyl)thiourea is sourced from PubChem (CID 2731037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).