About 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea
1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea (PubChem CID 2731049) has the molecular formula C21H28N2O4S
and a molecular weight of 404.53 g/mol. Its IUPAC name is 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea.
Molecular Properties
| Compound Name | 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
| PubChem CID | 2731049 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)NCCc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H28N2O4S/c1-24-17-7-5-15(13-19(17)26-3)9-11-22-21(28)23-12-10-16-6-8-18(25-2)20(14-16)27-4/h5-8,13-14H,9-12H2,1-4H3,(H2,22,23,28) |
| InChIKey | MBJXWDYDOGMUJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea?
The IUPAC name of 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea (CID 2731049) is 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea.
What is the SMILES notation for 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea?
The canonical SMILES for 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea is COc1ccc(CCNC(=S)NCCc2ccc(OC)c(OC)c2)cc1OC.
What is the InChIKey of 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea?
The InChIKey is MBJXWDYDOGMUJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O4S/c1-24-17-7-5-15(13-19(17)26-3)9-11-22-21(28)23-12-10-16-6-8-18(25-2)20(14-16)27-4/h5-8,13-14H,9-12H2,1-4H3,(H2,22,23,28).
What are the key properties of 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea?
1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea has a molecular weight of 404.53 g/mol, XLogP of 2.97, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[2-(3,4-dimethoxyphenyl)ethyl]thiourea is sourced from PubChem (CID 2731049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).