C12H14N2O4 — CID 2731143
5-methyl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 2731143) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 5-methyl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-methyl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2731143 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5-methyl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1cc(-c2noc(C)n2)cc(OC)c1OC |
| InChI | InChI=1S/C12H14N2O4/c1-7-13-12(14-18-7)8-5-9(15-2)11(17-4)10(6-8)16-3/h5-6H,1-4H3 |
| InChIKey | FYJLFBNDWNPQQB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |