About 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea
3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea (PubChem CID 2731210) has the molecular formula C11H15ClN2O2S
and a molecular weight of 274.77 g/mol. Its IUPAC name is 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea.
Molecular Properties
| Compound Name | 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea |
| PubChem CID | 2731210 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea |
| SMILES | COc1cc(NC(=S)N(C)C)c(OC)cc1Cl |
| InChI | InChI=1S/C11H15ClN2O2S/c1-14(2)11(17)13-8-6-9(15-3)7(12)5-10(8)16-4/h5-6H,1-4H3,(H,13,17) |
| InChIKey | JGMFHSHJZPIOND-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea?
The IUPAC name of 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea (CID 2731210) is 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea.
What is the SMILES notation for 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea?
The canonical SMILES for 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea is COc1cc(NC(=S)N(C)C)c(OC)cc1Cl.
What is the InChIKey of 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea?
The InChIKey is JGMFHSHJZPIOND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O2S/c1-14(2)11(17)13-8-6-9(15-3)7(12)5-10(8)16-4/h5-6H,1-4H3,(H,13,17).
What are the key properties of 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea?
3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea has a molecular weight of 274.77 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-2,5-dimethoxyphenyl)-1,1-dimethylthiourea is sourced from PubChem (CID 2731210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).