About 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile
1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile (PubChem CID 2731573) has the molecular formula C19H12Cl2N2O
and a molecular weight of 355.22 g/mol. Its IUPAC name is 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile.
Molecular Properties
| Compound Name | 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile |
| PubChem CID | 2731573 |
| Molecular Formula | C19H12Cl2N2O |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile |
| SMILES | Cc1cc2ccccc2c(/N=C/c2cc(Cl)cc(Cl)c2O)c1C#N |
| InChI | InChI=1S/C19H12Cl2N2O/c1-11-6-12-4-2-3-5-15(12)18(16(11)9-22)23-10-13-7-14(20)8-17(21)19(13)24/h2-8,10,24H,1H3/b23-10+ |
| InChIKey | KNTDTLNALDKSKJ-AUEPDCJTSA-N |
| XLogP | 5.78 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile?
The IUPAC name of 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile (CID 2731573) is 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile.
What is the SMILES notation for 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile?
The canonical SMILES for 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile is Cc1cc2ccccc2c(/N=C/c2cc(Cl)cc(Cl)c2O)c1C#N.
What is the InChIKey of 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile?
The InChIKey is KNTDTLNALDKSKJ-AUEPDCJTSA-N. The full InChI is InChI=1S/C19H12Cl2N2O/c1-11-6-12-4-2-3-5-15(12)18(16(11)9-22)23-10-13-7-14(20)8-17(21)19(13)24/h2-8,10,24H,1H3/b23-10+.
What are the key properties of 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile?
1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile has a molecular weight of 355.22 g/mol, XLogP of 5.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-methylnaphthalene-2-carbonitrile is sourced from PubChem (CID 2731573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).