C11H14N2O2S — CID 2731591
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,1-dimethylthiourea (PubChem CID 2731591) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,1-dimethylthiourea.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 2731591 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H14N2O2S/c1-13(2)11(16)12-8-3-4-9-10(7-8)15-6-5-14-9/h3-4,7H,5-6H2,1-2H3,(H,12,16) |
| InChIKey | CRWAURQDMQWZKG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|