C10H13N3O — CID 2731669
5,5-dimethyl-2-phenyl-1,2,4-triazolidin-3-one (PubChem CID 2731669) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 5,5-dimethyl-2-phenyl-1,2,4-triazolidin-3-one.
| Compound Name | 5,5-dimethyl-2-phenyl-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 2731669 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 5,5-dimethyl-2-phenyl-1,2,4-triazolidin-3-one |
| SMILES | CC1(C)NC(=O)N(c2ccccc2)N1 |
| InChI | InChI=1S/C10H13N3O/c1-10(2)11-9(14)13(12-10)8-6-4-3-5-7-8/h3-7,12H,1-2H3,(H,11,14) |
| InChIKey | XJXPBRAVNRXHHS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |