About 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione
1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione (PubChem CID 2731713) has the molecular formula C22H17Br2NO2
and a molecular weight of 487.19 g/mol. Its IUPAC name is 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione.
Molecular Properties
| Compound Name | 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione |
| PubChem CID | 2731713 |
| Molecular Formula | C22H17Br2NO2 |
| Molecular Weight | 487.19 g/mol |
| Exact Mass | 484.96 |
| IUPAC Name | 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione |
| SMILES | O=C(CC(CC(=O)c1ccc(Br)cc1)c1cccnc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H17Br2NO2/c23-19-7-3-15(4-8-19)21(26)12-18(17-2-1-11-25-14-17)13-22(27)16-5-9-20(24)10-6-16/h1-11,14,18H,12-13H2 |
| InChIKey | IHDBDRBVTZTZJE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.19 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione?
The IUPAC name of 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione (CID 2731713) is 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione.
What is the SMILES notation for 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione?
The canonical SMILES for 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione is O=C(CC(CC(=O)c1ccc(Br)cc1)c1cccnc1)c1ccc(Br)cc1.
What is the InChIKey of 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione?
The InChIKey is IHDBDRBVTZTZJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17Br2NO2/c23-19-7-3-15(4-8-19)21(26)12-18(17-2-1-11-25-14-17)13-22(27)16-5-9-20(24)10-6-16/h1-11,14,18H,12-13H2.
What are the key properties of 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione?
1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione has a molecular weight of 487.19 g/mol, XLogP of 6.24, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(4-bromophenyl)-3-pyridin-3-ylpentane-1,5-dione is sourced from PubChem (CID 2731713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).