C18H18N2O5 — CID 2731732
1-[(3,4,5-trimethoxyanilino)methyl]indole-2,3-dione (PubChem CID 2731732) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 1-[(3,4,5-trimethoxyanilino)methyl]indole-2,3-dione.
| Compound Name | 1-[(3,4,5-trimethoxyanilino)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 2731732 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-[(3,4,5-trimethoxyanilino)methyl]indole-2,3-dione |
| SMILES | COc1cc(NCN2C(=O)C(=O)c3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C18H18N2O5/c1-23-14-8-11(9-15(24-2)17(14)25-3)19-10-20-13-7-5-4-6-12(13)16(21)18(20)22/h4-9,19H,10H2,1-3H3 |
| InChIKey | PMOXSSDYTPGESZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|