About 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide
1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide (PubChem CID 2731763) has the molecular formula C14H28N4S2
and a molecular weight of 316.54 g/mol. Its IUPAC name is 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide.
Molecular Properties
| Compound Name | 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide |
| PubChem CID | 2731763 |
| Molecular Formula | C14H28N4S2 |
| Molecular Weight | 316.54 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide |
| SMILES | CC(C)(C)NC(=S)N1CCN(C(=S)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H28N4S2/c1-13(2,3)15-11(19)17-7-9-18(10-8-17)12(20)16-14(4,5)6/h7-10H2,1-6H3,(H,15,19)(H,16,20) |
| InChIKey | FVFFCYVWBHMBLN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide?
The IUPAC name of 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide (CID 2731763) is 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide.
What is the SMILES notation for 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide?
The canonical SMILES for 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide is CC(C)(C)NC(=S)N1CCN(C(=S)NC(C)(C)C)CC1.
What is the InChIKey of 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide?
The InChIKey is FVFFCYVWBHMBLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4S2/c1-13(2,3)15-11(19)17-7-9-18(10-8-17)12(20)16-14(4,5)6/h7-10H2,1-6H3,(H,15,19)(H,16,20).
What are the key properties of 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide?
1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide has a molecular weight of 316.54 g/mol, XLogP of 1.95, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-ditert-butylpiperazine-1,4-dicarbothioamide is sourced from PubChem (CID 2731763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).