C14H11ClN2OS — CID 2731884
3-(4-chlorophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one (PubChem CID 2731884) has the molecular formula C14H11ClN2OS and a molecular weight of 290.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-chlorophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2731884 |
| Molecular Formula | C14H11ClN2OS |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 3-(4-chlorophenyl)-2-pyridin-3-yl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2cccnc2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H11ClN2OS/c15-11-3-5-12(6-4-11)17-13(18)9-19-14(17)10-2-1-7-16-8-10/h1-8,14H,9H2 |
| InChIKey | BMJBELLWVIGIMS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |