About prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate
prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate (PubChem CID 2731977) has the molecular formula C14H12N2O3
and a molecular weight of 256.26 g/mol. Its IUPAC name is prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate.
Molecular Properties
| Compound Name | prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate |
| PubChem CID | 2731977 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate |
| SMILES | C#CCOC(=O)Nc1c(-c2ccccc2)noc1C |
| InChI | InChI=1S/C14H12N2O3/c1-3-9-18-14(17)15-12-10(2)19-16-13(12)11-7-5-4-6-8-11/h1,4-8H,9H2,2H3,(H,15,17) |
| InChIKey | HHIJTDPBBHWSLQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate?
The IUPAC name of prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate (CID 2731977) is prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate.
What is the SMILES notation for prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate?
The canonical SMILES for prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate is C#CCOC(=O)Nc1c(-c2ccccc2)noc1C.
What is the InChIKey of prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate?
The InChIKey is HHIJTDPBBHWSLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3/c1-3-9-18-14(17)15-12-10(2)19-16-13(12)11-7-5-4-6-8-11/h1,4-8H,9H2,2H3,(H,15,17).
What are the key properties of prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate?
prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate has a molecular weight of 256.26 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate is sourced from PubChem (CID 2731977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).