C18H18ClN3O2S — CID 2732215
4-(3-chloro-4-methylphenyl)-3-[(3,4-dimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 2732215) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is 4-(3-chloro-4-methylphenyl)-3-[(3,4-dimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(3-chloro-4-methylphenyl)-3-[(3,4-dimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2732215 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 4-(3-chloro-4-methylphenyl)-3-[(3,4-dimethoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(Cc2n[nH]c(=S)n2-c2ccc(C)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H18ClN3O2S/c1-11-4-6-13(10-14(11)19)22-17(20-21-18(22)25)9-12-5-7-15(23-2)16(8-12)24-3/h4-8,10H,9H2,1-3H3,(H,21,25) |
| InChIKey | GDMOSTALIWRZTH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|