About 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid
5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid (PubChem CID 2732321) has the molecular formula C14H13F6NO3
and a molecular weight of 357.25 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid |
| PubChem CID | 2732321 |
| Molecular Formula | C14H13F6NO3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13F6NO3/c1-7(3-12(23)24)2-11(22)21-10-5-8(13(15,16)17)4-9(6-10)14(18,19)20/h4-7H,2-3H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | UXAILUBQNRXBGU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid?
The IUPAC name of 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid (CID 2732321) is 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid.
What is the SMILES notation for 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid?
The canonical SMILES for 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid is CC(CC(=O)O)CC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid?
The InChIKey is UXAILUBQNRXBGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F6NO3/c1-7(3-12(23)24)2-11(22)21-10-5-8(13(15,16)17)4-9(6-10)14(18,19)20/h4-7H,2-3H2,1H3,(H,21,22)(H,23,24).
What are the key properties of 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid?
5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid has a molecular weight of 357.25 g/mol, XLogP of 4.16, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(trifluoromethyl)anilino]-3-methyl-5-oxopentanoic acid is sourced from PubChem (CID 2732321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).