C15H15F6NO3 — CID 2732369
5-[3,5-bis(trifluoromethyl)anilino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 2732369) has the molecular formula C15H15F6NO3 and a molecular weight of 371.28 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)anilino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[3,5-bis(trifluoromethyl)anilino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 2732369 |
| Molecular Formula | C15H15F6NO3 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)anilino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CC(C)(CC(=O)O)CC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F6NO3/c1-13(2,7-12(24)25)6-11(23)22-10-4-8(14(16,17)18)3-9(5-10)15(19,20)21/h3-5H,6-7H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | WNVMQFIRNJVNDT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |