About 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one
2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 2732522) has the molecular formula C17H11F6NOS
and a molecular weight of 391.34 g/mol. Its IUPAC name is 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| PubChem CID | 2732522 |
| Molecular Formula | C17H11F6NOS |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(C(F)(F)F)cc2)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11F6NOS/c18-16(19,20)11-3-1-10(2-4-11)15-24(14(25)9-26-15)13-7-5-12(6-8-13)17(21,22)23/h1-8,15H,9H2 |
| InChIKey | QGFDDCDNTZPCDN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one?
The IUPAC name of 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (CID 2732522) is 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
What is the SMILES notation for 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one?
The canonical SMILES for 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one is O=C1CSC(c2ccc(C(F)(F)F)cc2)N1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one?
The InChIKey is QGFDDCDNTZPCDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F6NOS/c18-16(19,20)11-3-1-10(2-4-11)15-24(14(25)9-26-15)13-7-5-12(6-8-13)17(21,22)23/h1-8,15H,9H2.
What are the key properties of 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one?
2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one has a molecular weight of 391.34 g/mol, XLogP of 5.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one is sourced from PubChem (CID 2732522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).