About S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate
S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate (PubChem CID 2732532) has the molecular formula C13H10F3NO3S
and a molecular weight of 317.29 g/mol. Its IUPAC name is S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate.
Molecular Properties
| Compound Name | S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate |
| PubChem CID | 2732532 |
| Molecular Formula | C13H10F3NO3S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C13H10F3NO3S/c1-7(18)21-10-6-11(19)17(12(10)20)9-4-2-8(3-5-9)13(14,15)16/h2-5,10H,6H2,1H3 |
| InChIKey | DHQLMIMAFIJCGZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate?
The IUPAC name of S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate (CID 2732532) is S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate.
What is the SMILES notation for S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate?
The canonical SMILES for S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate is CC(=O)SC1CC(=O)N(c2ccc(C(F)(F)F)cc2)C1=O.
What is the InChIKey of S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate?
The InChIKey is DHQLMIMAFIJCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3NO3S/c1-7(18)21-10-6-11(19)17(12(10)20)9-4-2-8(3-5-9)13(14,15)16/h2-5,10H,6H2,1H3.
What are the key properties of S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate?
S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate has a molecular weight of 317.29 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl] ethanethioate is sourced from PubChem (CID 2732532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).