About 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile
2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile (PubChem CID 2732644) has the molecular formula C16H10F6N2
and a molecular weight of 344.26 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile |
| PubChem CID | 2732644 |
| Molecular Formula | C16H10F6N2 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile |
| SMILES | N#CC(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C16H10F6N2/c17-15(18,19)11-6-12(16(20,21)22)8-13(7-11)24-14(9-23)10-4-2-1-3-5-10/h1-8,14,24H |
| InChIKey | URODBIOXQDKVQS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile (CID 2732644) is 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile is N#CC(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1.
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile?
The InChIKey is URODBIOXQDKVQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F6N2/c17-15(18,19)11-6-12(16(20,21)22)8-13(7-11)24-14(9-23)10-4-2-1-3-5-10/h1-8,14,24H.
What are the key properties of 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile?
2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile has a molecular weight of 344.26 g/mol, XLogP of 5.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)anilino]-2-phenylacetonitrile is sourced from PubChem (CID 2732644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).