C12H11NO4S — CID 2732735
2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylacetic acid (PubChem CID 2732735) has the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylacetic acid.
| Compound Name | 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 2732735 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylacetic acid |
| SMILES | O=C(O)CSC1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C12H11NO4S/c14-10-6-9(18-7-11(15)16)12(17)13(10)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,15,16) |
| InChIKey | YTNPLWOAHMUJEA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|