C17H15F2N3O3S — CID 2732805
(5E)-3-(2,4-difluorophenyl)-5-(dimethylaminomethylidene)-1,1-dioxo-2-pyridin-3-yl-1,3-thiazolidin-4-one (PubChem CID 2732805) has the molecular formula C17H15F2N3O3S and a molecular weight of 379.39 g/mol. Its IUPAC name is (5E)-3-(2,4-difluorophenyl)-5-(dimethylaminomethylidene)-1,1-dioxo-2-pyridin-3-yl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2,4-difluorophenyl)-5-(dimethylaminomethylidene)-1,1-dioxo-2-pyridin-3-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2732805 |
| Molecular Formula | C17H15F2N3O3S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (5E)-3-(2,4-difluorophenyl)-5-(dimethylaminomethylidene)-1,1-dioxo-2-pyridin-3-yl-1,3-thiazolidin-4-one |
| SMILES | CN(C)/C=C1\C(=O)N(c2ccc(F)cc2F)C(c2cccnc2)S1(=O)=O |
| InChI | InChI=1S/C17H15F2N3O3S/c1-21(2)10-15-16(23)22(14-6-5-12(18)8-13(14)19)17(26(15,24)25)11-4-3-7-20-9-11/h3-10,17H,1-2H3/b15-10+ |
| InChIKey | DFWWVXWXNCXMEG-XNTDXEJSSA-N |
| XLogP | 2.22 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|