About [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate
[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate (PubChem CID 2732889) has the molecular formula C23H27NO3
and a molecular weight of 365.47 g/mol. Its IUPAC name is [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate |
| PubChem CID | 2732889 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate |
| SMILES | CC1(C)COC(c2ccccc2COC(=O)c2ccc(C(C)(C)C)cc2)=N1 |
| InChI | InChI=1S/C23H27NO3/c1-22(2,3)18-12-10-16(11-13-18)21(25)26-14-17-8-6-7-9-19(17)20-24-23(4,5)15-27-20/h6-13H,14-15H2,1-5H3 |
| InChIKey | DUJQMVHISMNNPF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate?
The IUPAC name of [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate (CID 2732889) is [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate.
What is the SMILES notation for [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate?
The canonical SMILES for [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate is CC1(C)COC(c2ccccc2COC(=O)c2ccc(C(C)(C)C)cc2)=N1.
What is the InChIKey of [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate?
The InChIKey is DUJQMVHISMNNPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO3/c1-22(2,3)18-12-10-16(11-13-18)21(25)26-14-17-8-6-7-9-19(17)20-24-23(4,5)15-27-20/h6-13H,14-15H2,1-5H3.
What are the key properties of [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate?
[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate has a molecular weight of 365.47 g/mol, XLogP of 4.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]methyl 4-tert-butylbenzoate is sourced from PubChem (CID 2732889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).