About (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol
(2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol (PubChem CID 2733099) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol |
| PubChem CID | 2733099 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol |
| SMILES | CC[C@H](CO)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H17NO/c1-2-12(9-14)13-7-10-5-3-4-6-11(10)8-13/h3-6,12,14H,2,7-9H2,1H3/t12-/m1/s1 |
| InChIKey | OGAAQVONYOTBGB-GFCCVEGCSA-N |
| XLogP | 1.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol?
The IUPAC name of (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol (CID 2733099) is (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol.
What is the SMILES notation for (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol?
The canonical SMILES for (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol is CC[C@H](CO)N1Cc2ccccc2C1.
What is the InChIKey of (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol?
The InChIKey is OGAAQVONYOTBGB-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H17NO/c1-2-12(9-14)13-7-10-5-3-4-6-11(10)8-13/h3-6,12,14H,2,7-9H2,1H3/t12-/m1/s1.
What are the key properties of (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol?
(2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol has a molecular weight of 191.27 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1,3-dihydroisoindol-2-yl)butan-1-ol is sourced from PubChem (CID 2733099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).