C2H6O2 — CID 2733137
1,1,2,2-tetradeuterioethane-1,2-diol (PubChem CID 2733137) has the molecular formula C2H6O2 and a molecular weight of 66.09 g/mol. Its IUPAC name is 1,1,2,2-tetradeuterioethane-1,2-diol.
| Compound Name | 1,1,2,2-tetradeuterioethane-1,2-diol |
|---|---|
| PubChem CID | 2733137 |
| Molecular Formula | C2H6O2 |
| Molecular Weight | 66.09 g/mol |
| Exact Mass | 66.06 |
| IUPAC Name | 1,1,2,2-tetradeuterioethane-1,2-diol |
| SMILES | [2H]C([2H])(O)C([2H])([2H])O |
| InChI | InChI=1S/C2H6O2/c3-1-2-4/h3-4H,1-2H2/i1D2,2D2 |
| InChIKey | LYCAIKOWRPUZTN-LNLMKGTHSA-N |
| XLogP | -1.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 4 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 66.09 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |