C20H15N3 — CID 2733186
2,4,5-Triphenyl-4H-1,2,4-triazol-2-ium-3-ide (PubChem CID 2733186) has the molecular formula C20H15N3 and a molecular weight of 297.36 g/mol.
| Compound Name | 2,4,5-Triphenyl-4H-1,2,4-triazol-2-ium-3-ide |
|---|---|
| PubChem CID | 2733186 |
| Molecular Formula | C20H15N3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | — |
| SMILES | [c-]1n(-c2ccccc2)c(-c2ccccc2)n[n+]1-c1ccccc1 |
| InChI | InChI=1S/C20H15N3/c1-4-10-17(11-5-1)20-21-23(19-14-8-3-9-15-19)16-22(20)18-12-6-2-7-13-18/h1-15H |
| InChIKey | QZHWOLKBXYORRO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|