C19H17N3OS2 — CID 27332086
(7R,8R)-2-methyl-8-phenyl-7-phenylsulfanyl-7,8-dihydro-6H-[1,3]thiazino[3,2-b][1,2,4]triazin-3-one (PubChem CID 27332086) has the molecular formula C19H17N3OS2 and a molecular weight of 367.50 g/mol. Its IUPAC name is (7R,8R)-2-methyl-8-phenyl-7-phenylsulfanyl-7,8-dihydro-6H-[1,3]thiazino[3,2-b][1,2,4]triazin-3-one.
| Compound Name | (7R,8R)-2-methyl-8-phenyl-7-phenylsulfanyl-7,8-dihydro-6H-[1,3]thiazino[3,2-b][1,2,4]triazin-3-one |
|---|---|
| PubChem CID | 27332086 |
| Molecular Formula | C19H17N3OS2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (7R,8R)-2-methyl-8-phenyl-7-phenylsulfanyl-7,8-dihydro-6H-[1,3]thiazino[3,2-b][1,2,4]triazin-3-one |
| SMILES | Cc1nn2c(nc1=O)SC[C@H](Sc1ccccc1)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C19H17N3OS2/c1-13-18(23)20-19-22(21-13)17(14-8-4-2-5-9-14)16(12-24-19)25-15-10-6-3-7-11-15/h2-11,16-17H,12H2,1H3/t16-,17+/m0/s1 |
| InChIKey | YVFSJUHCEQPPGQ-DLBZAZTESA-N |
| XLogP | 3.80 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |