(E)-3-(3,4-difluorophenyl)prop-2-enoic acid

C9H6F2O2 — CID 2733300

IUPAC(E)-3-(3,4-difluorophenyl)prop-2-enoic acid
SMILESO=C(O)/C=C/c1ccc(F)c(F)c1
InChIInChI=1S/C9H6F2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+
InChIKeyHXBOHZQZTWAEHJ-DUXPYHPUSA-N
MW184.14 g/mol
LogP2.06
Rot. Bonds2

About (E)-3-(3,4-difluorophenyl)prop-2-enoic acid

(E)-3-(3,4-difluorophenyl)prop-2-enoic acid (PubChem CID 2733300) has the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. Its IUPAC name is (E)-3-(3,4-difluorophenyl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(3,4-difluorophenyl)prop-2-enoic acid
PubChem CID2733300
Molecular FormulaC9H6F2O2
Molecular Weight184.14 g/mol
Exact Mass184.03
IUPAC Name(E)-3-(3,4-difluorophenyl)prop-2-enoic acid
SMILESO=C(O)/C=C/c1ccc(F)c(F)c1
InChIInChI=1S/C9H6F2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+
InChIKeyHXBOHZQZTWAEHJ-DUXPYHPUSA-N
XLogP2.06
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.14
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(3,4-difluorophenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(3,4-difluorophenyl)prop-2-enoic acid?
The IUPAC name of (E)-3-(3,4-difluorophenyl)prop-2-enoic acid (CID 2733300) is (E)-3-(3,4-difluorophenyl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(3,4-difluorophenyl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(3,4-difluorophenyl)prop-2-enoic acid is O=C(O)/C=C/c1ccc(F)c(F)c1.
What is the InChIKey of (E)-3-(3,4-difluorophenyl)prop-2-enoic acid?
The InChIKey is HXBOHZQZTWAEHJ-DUXPYHPUSA-N. The full InChI is InChI=1S/C9H6F2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+.
What are the key properties of (E)-3-(3,4-difluorophenyl)prop-2-enoic acid?
(E)-3-(3,4-difluorophenyl)prop-2-enoic acid has a molecular weight of 184.14 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,4-difluorophenyl)prop-2-enoic acid is sourced from PubChem (CID 2733300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).