About 2,4-diisocyanato-1,3,5-trimethylbenzene
2,4-diisocyanato-1,3,5-trimethylbenzene (PubChem CID 2733394) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 2,4-diisocyanato-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2,4-diisocyanato-1,3,5-trimethylbenzene |
| PubChem CID | 2733394 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2,4-diisocyanato-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(N=C=O)c(C)c1N=C=O |
| InChI | InChI=1S/C11H10N2O2/c1-7-4-8(2)11(13-6-15)9(3)10(7)12-5-14/h4H,1-3H3 |
| InChIKey | OSVNEGAPNXBADJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diisocyanato-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diisocyanato-1,3,5-trimethylbenzene?
The IUPAC name of 2,4-diisocyanato-1,3,5-trimethylbenzene (CID 2733394) is 2,4-diisocyanato-1,3,5-trimethylbenzene.
What is the SMILES notation for 2,4-diisocyanato-1,3,5-trimethylbenzene?
The canonical SMILES for 2,4-diisocyanato-1,3,5-trimethylbenzene is Cc1cc(C)c(N=C=O)c(C)c1N=C=O.
What is the InChIKey of 2,4-diisocyanato-1,3,5-trimethylbenzene?
The InChIKey is OSVNEGAPNXBADJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c1-7-4-8(2)11(13-6-15)9(3)10(7)12-5-14/h4H,1-3H3.
What are the key properties of 2,4-diisocyanato-1,3,5-trimethylbenzene?
2,4-diisocyanato-1,3,5-trimethylbenzene has a molecular weight of 202.21 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diisocyanato-1,3,5-trimethylbenzene is sourced from PubChem (CID 2733394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).