About 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene
1-isothiocyanato-3,5-bis(trifluoromethyl)benzene (PubChem CID 2733395) has the molecular formula C9H3F6NS
and a molecular weight of 271.19 g/mol. Its IUPAC name is 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene |
| PubChem CID | 2733395 |
| Molecular Formula | C9H3F6NS |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(N=C=S)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H3F6NS/c10-8(11,12)5-1-6(9(13,14)15)3-7(2-5)16-4-17/h1-3H |
| InChIKey | FXOSSGVJGGNASE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene?
The IUPAC name of 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene (CID 2733395) is 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene.
What is the SMILES notation for 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene?
The canonical SMILES for 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene is FC(F)(F)c1cc(N=C=S)cc(C(F)(F)F)c1.
What is the InChIKey of 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene?
The InChIKey is FXOSSGVJGGNASE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3F6NS/c10-8(11,12)5-1-6(9(13,14)15)3-7(2-5)16-4-17/h1-3H.
What are the key properties of 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene?
1-isothiocyanato-3,5-bis(trifluoromethyl)benzene has a molecular weight of 271.19 g/mol, XLogP of 4.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isothiocyanato-3,5-bis(trifluoromethyl)benzene is sourced from PubChem (CID 2733395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).