C6H7N — CID 2733418
N,N,2,3,4,5,6-heptadeuterioaniline (PubChem CID 2733418) has the molecular formula C6H7N and a molecular weight of 100.17 g/mol. Its IUPAC name is N,N,2,3,4,5,6-heptadeuterioaniline.
| Compound Name | N,N,2,3,4,5,6-heptadeuterioaniline |
|---|---|
| PubChem CID | 2733418 |
| Molecular Formula | C6H7N |
| Molecular Weight | 100.17 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | N,N,2,3,4,5,6-heptadeuterioaniline |
| SMILES | [2H]c1c([2H])c([2H])c(N([2H])[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C6H7N/c7-6-4-2-1-3-5-6/h1-5H,7H2/i1D,2D,3D,4D,5D/hD2 |
| InChIKey | PAYRUJLWNCNPSJ-LQHBDRBESA-N |
| XLogP | 1.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|