About 2,3,4,5-tetradeuteriofuran
2,3,4,5-tetradeuteriofuran (PubChem CID 2733420) has the molecular formula C4H4O
and a molecular weight of 72.10 g/mol. Its IUPAC name is 2,3,4,5-tetradeuteriofuran.
Molecular Properties
| Compound Name | 2,3,4,5-tetradeuteriofuran |
| PubChem CID | 2733420 |
| Molecular Formula | C4H4O |
| Molecular Weight | 72.10 g/mol |
| Exact Mass | 72.05 |
| IUPAC Name | 2,3,4,5-tetradeuteriofuran |
| SMILES | [2H]c1oc([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C4H4O/c1-2-4-5-3-1/h1-4H/i1D,2D,3D,4D |
| InChIKey | YLQBMQCUIZJEEH-RHQRLBAQSA-N |
| XLogP | 1.28 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 72.10 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4,5-tetradeuteriofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetradeuteriofuran?
The IUPAC name of 2,3,4,5-tetradeuteriofuran (CID 2733420) is 2,3,4,5-tetradeuteriofuran.
What is the SMILES notation for 2,3,4,5-tetradeuteriofuran?
The canonical SMILES for 2,3,4,5-tetradeuteriofuran is [2H]c1oc([2H])c([2H])c1[2H].
What is the InChIKey of 2,3,4,5-tetradeuteriofuran?
The InChIKey is YLQBMQCUIZJEEH-RHQRLBAQSA-N. The full InChI is InChI=1S/C4H4O/c1-2-4-5-3-1/h1-4H/i1D,2D,3D,4D.
What are the key properties of 2,3,4,5-tetradeuteriofuran?
2,3,4,5-tetradeuteriofuran has a molecular weight of 72.10 g/mol, XLogP of 1.28, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetradeuteriofuran is sourced from PubChem (CID 2733420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).