C13H17N2O2 — CID 2733513
2-Phenyl-4,4,5,5-tetramethylimidazoline-1-oxyl 3-oxide (PubChem CID 2733513) has the molecular formula C13H17N2O2 and a molecular weight of 233.29 g/mol.
| Compound Name | 2-Phenyl-4,4,5,5-tetramethylimidazoline-1-oxyl 3-oxide |
|---|---|
| PubChem CID | 2733513 |
| Molecular Formula | C13H17N2O2 |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | — |
| SMILES | CC1(C)N([O])C(c2ccccc2)=[N+]([O-])C1(C)C |
| InChI | InChI=1S/C13H17N2O2/c1-12(2)13(3,4)15(17)11(14(12)16)10-8-6-5-7-9-10/h5-9H,1-4H3 |
| InChIKey | DYUUGILMVYJEHY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|