About trimethylsilyl 3,3-dimethylbutanoate
trimethylsilyl 3,3-dimethylbutanoate (PubChem CID 2733558) has the molecular formula C9H20O2Si
and a molecular weight of 188.34 g/mol. Its IUPAC name is trimethylsilyl 3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | trimethylsilyl 3,3-dimethylbutanoate |
| PubChem CID | 2733558 |
| Molecular Formula | C9H20O2Si |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | trimethylsilyl 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C9H20O2Si/c1-9(2,3)7-8(10)11-12(4,5)6/h7H2,1-6H3 |
| InChIKey | SNWZEHDUHRRRJL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 3,3-dimethylbutanoate?
The IUPAC name of trimethylsilyl 3,3-dimethylbutanoate (CID 2733558) is trimethylsilyl 3,3-dimethylbutanoate.
What is the SMILES notation for trimethylsilyl 3,3-dimethylbutanoate?
The canonical SMILES for trimethylsilyl 3,3-dimethylbutanoate is CC(C)(C)CC(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 3,3-dimethylbutanoate?
The InChIKey is SNWZEHDUHRRRJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2Si/c1-9(2,3)7-8(10)11-12(4,5)6/h7H2,1-6H3.
What are the key properties of trimethylsilyl 3,3-dimethylbutanoate?
trimethylsilyl 3,3-dimethylbutanoate has a molecular weight of 188.34 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 3,3-dimethylbutanoate is sourced from PubChem (CID 2733558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).