(2R)-2-methoxypropanoic acid

C4H8O3 — CID 2733584

IUPAC(2R)-2-methoxypropanoic acid
SMILESCO[C@H](C)C(=O)O
InChIInChI=1S/C4H8O3/c1-3(7-2)4(5)6/h3H,1-2H3,(H,5,6)/t3-/m1/s1
InChIKeyICPWFHKNYYRBSZ-GSVOUGTGSA-N
MW104.11 g/mol
LogP0.11
Rot. Bonds2

About (2R)-2-methoxypropanoic acid

(2R)-2-methoxypropanoic acid (PubChem CID 2733584) has the molecular formula C4H8O3 and a molecular weight of 104.11 g/mol. Its IUPAC name is (2R)-2-methoxypropanoic acid.

Molecular Properties

Compound Name(2R)-2-methoxypropanoic acid
PubChem CID2733584
Molecular FormulaC4H8O3
Molecular Weight104.11 g/mol
Exact Mass104.05
IUPAC Name(2R)-2-methoxypropanoic acid
SMILESCO[C@H](C)C(=O)O
InChIInChI=1S/C4H8O3/c1-3(7-2)4(5)6/h3H,1-2H3,(H,5,6)/t3-/m1/s1
InChIKeyICPWFHKNYYRBSZ-GSVOUGTGSA-N
XLogP0.11
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500104.11
LogP ≤ 50.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2R)-2-methoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-methoxypropanoic acid?
The IUPAC name of (2R)-2-methoxypropanoic acid (CID 2733584) is (2R)-2-methoxypropanoic acid.
What is the SMILES notation for (2R)-2-methoxypropanoic acid?
The canonical SMILES for (2R)-2-methoxypropanoic acid is CO[C@H](C)C(=O)O.
What is the InChIKey of (2R)-2-methoxypropanoic acid?
The InChIKey is ICPWFHKNYYRBSZ-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H8O3/c1-3(7-2)4(5)6/h3H,1-2H3,(H,5,6)/t3-/m1/s1.
What are the key properties of (2R)-2-methoxypropanoic acid?
(2R)-2-methoxypropanoic acid has a molecular weight of 104.11 g/mol, XLogP of 0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methoxypropanoic acid is sourced from PubChem (CID 2733584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).