About (3S)-3-aminooxolan-2-one;hydrochloride
(3S)-3-aminooxolan-2-one;hydrochloride (PubChem CID 2733667) has the molecular formula C4H8ClNO2
and a molecular weight of 137.57 g/mol. Its IUPAC name is (3S)-3-aminooxolan-2-one;hydrochloride.
Molecular Properties
| Compound Name | (3S)-3-aminooxolan-2-one;hydrochloride |
| PubChem CID | 2733667 |
| Molecular Formula | C4H8ClNO2 |
| Molecular Weight | 137.57 g/mol |
| Exact Mass | 137.02 |
| IUPAC Name | (3S)-3-aminooxolan-2-one;hydrochloride |
| SMILES | Cl.N[C@H]1CCOC1=O |
| InChI | InChI=1S/C4H7NO2.ClH/c5-3-1-2-7-4(3)6;/h3H,1-2,5H2;1H/t3-;/m0./s1 |
| InChIKey | XBKCXPRYTLOQKS-DFWYDOINSA-N |
| XLogP | -0.32 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.57 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-aminooxolan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-aminooxolan-2-one;hydrochloride?
The IUPAC name of (3S)-3-aminooxolan-2-one;hydrochloride (CID 2733667) is (3S)-3-aminooxolan-2-one;hydrochloride.
What is the SMILES notation for (3S)-3-aminooxolan-2-one;hydrochloride?
The canonical SMILES for (3S)-3-aminooxolan-2-one;hydrochloride is Cl.N[C@H]1CCOC1=O.
What is the InChIKey of (3S)-3-aminooxolan-2-one;hydrochloride?
The InChIKey is XBKCXPRYTLOQKS-DFWYDOINSA-N. The full InChI is InChI=1S/C4H7NO2.ClH/c5-3-1-2-7-4(3)6;/h3H,1-2,5H2;1H/t3-;/m0./s1.
What are the key properties of (3S)-3-aminooxolan-2-one;hydrochloride?
(3S)-3-aminooxolan-2-one;hydrochloride has a molecular weight of 137.57 g/mol, XLogP of -0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-aminooxolan-2-one;hydrochloride is sourced from PubChem (CID 2733667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).