About 3-amino-2-methylbenzoic acid
3-amino-2-methylbenzoic acid (PubChem CID 2733699) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 3-amino-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-amino-2-methylbenzoic acid |
| PubChem CID | 2733699 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3-amino-2-methylbenzoic acid |
| SMILES | Cc1c(N)cccc1C(=O)O |
| InChI | InChI=1S/C8H9NO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | BYHMLZGICSEKIY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-methylbenzoic acid?
The IUPAC name of 3-amino-2-methylbenzoic acid (CID 2733699) is 3-amino-2-methylbenzoic acid.
What is the SMILES notation for 3-amino-2-methylbenzoic acid?
The canonical SMILES for 3-amino-2-methylbenzoic acid is Cc1c(N)cccc1C(=O)O.
What is the InChIKey of 3-amino-2-methylbenzoic acid?
The InChIKey is BYHMLZGICSEKIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,9H2,1H3,(H,10,11).
What are the key properties of 3-amino-2-methylbenzoic acid?
3-amino-2-methylbenzoic acid has a molecular weight of 151.16 g/mol, XLogP of 1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-methylbenzoic acid is sourced from PubChem (CID 2733699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).