About 2,4,6-trichlorobenzoyl chloride
2,4,6-trichlorobenzoyl chloride (PubChem CID 2733703) has the molecular formula C7H2Cl4O
and a molecular weight of 243.90 g/mol. Its IUPAC name is 2,4,6-trichlorobenzoyl chloride.
Molecular Properties
| Compound Name | 2,4,6-trichlorobenzoyl chloride |
| PubChem CID | 2733703 |
| Molecular Formula | C7H2Cl4O |
| Molecular Weight | 243.90 g/mol |
| Exact Mass | 241.89 |
| IUPAC Name | 2,4,6-trichlorobenzoyl chloride |
| SMILES | O=C(Cl)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C7H2Cl4O/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H |
| InChIKey | OZGSEIVTQLXWRO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,4,6-trichlorobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trichlorobenzoyl chloride?
The IUPAC name of 2,4,6-trichlorobenzoyl chloride (CID 2733703) is 2,4,6-trichlorobenzoyl chloride.
What is the SMILES notation for 2,4,6-trichlorobenzoyl chloride?
The canonical SMILES for 2,4,6-trichlorobenzoyl chloride is O=C(Cl)c1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of 2,4,6-trichlorobenzoyl chloride?
The InChIKey is OZGSEIVTQLXWRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Cl4O/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H.
What are the key properties of 2,4,6-trichlorobenzoyl chloride?
2,4,6-trichlorobenzoyl chloride has a molecular weight of 243.90 g/mol, XLogP of 4.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trichlorobenzoyl chloride is sourced from PubChem (CID 2733703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).