C10H14BrNO2 — CID 2733730
1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide (PubChem CID 2733730) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide.
| Compound Name | 1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide |
|---|---|
| PubChem CID | 2733730 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 1-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrobromide |
| SMILES | Br.CC1NCCc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C10H13NO2.BrH/c1-6-8-5-10(13)9(12)4-7(8)2-3-11-6;/h4-6,11-13H,2-3H2,1H3;1H |
| InChIKey | OGMGXKJQIOUTTB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|