About [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine
[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine (PubChem CID 2733884) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine.
Molecular Properties
| Compound Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine |
| PubChem CID | 2733884 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine |
| SMILES | CC1(C)OC[C@H](CN)O1 |
| InChI | InChI=1S/C6H13NO2/c1-6(2)8-4-5(3-7)9-6/h5H,3-4,7H2,1-2H3/t5-/m0/s1 |
| InChIKey | HXOYWCSTHVTLOW-YFKPBYRVSA-N |
| XLogP | 0.10 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine?
The IUPAC name of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine (CID 2733884) is [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine.
What is the SMILES notation for [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine?
The canonical SMILES for [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine is CC1(C)OC[C@H](CN)O1.
What is the InChIKey of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine?
The InChIKey is HXOYWCSTHVTLOW-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H13NO2/c1-6(2)8-4-5(3-7)9-6/h5H,3-4,7H2,1-2H3/t5-/m0/s1.
What are the key properties of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine?
[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine has a molecular weight of 131.17 g/mol, XLogP of 0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine is sourced from PubChem (CID 2733884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).