About (2S)-2,3-dihydro-1H-indole-2-carboxylic acid
(2S)-2,3-dihydro-1H-indole-2-carboxylic acid (PubChem CID 2733920) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is (2S)-2,3-dihydro-1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-2,3-dihydro-1H-indole-2-carboxylic acid |
| PubChem CID | 2733920 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (2S)-2,3-dihydro-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C9H9NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-4,8,10H,5H2,(H,11,12)/t8-/m0/s1 |
| InChIKey | QNRXNRGSOJZINA-QMMMGPOBSA-N |
| XLogP | 1.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2,3-dihydro-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-dihydro-1H-indole-2-carboxylic acid?
The IUPAC name of (2S)-2,3-dihydro-1H-indole-2-carboxylic acid (CID 2733920) is (2S)-2,3-dihydro-1H-indole-2-carboxylic acid.
What is the SMILES notation for (2S)-2,3-dihydro-1H-indole-2-carboxylic acid?
The canonical SMILES for (2S)-2,3-dihydro-1H-indole-2-carboxylic acid is O=C(O)[C@@H]1Cc2ccccc2N1.
What is the InChIKey of (2S)-2,3-dihydro-1H-indole-2-carboxylic acid?
The InChIKey is QNRXNRGSOJZINA-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H9NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-4,8,10H,5H2,(H,11,12)/t8-/m0/s1.
What are the key properties of (2S)-2,3-dihydro-1H-indole-2-carboxylic acid?
(2S)-2,3-dihydro-1H-indole-2-carboxylic acid has a molecular weight of 163.18 g/mol, XLogP of 1.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-dihydro-1H-indole-2-carboxylic acid is sourced from PubChem (CID 2733920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).