C23H17ClO — CID 2734003
2,4,6-triphenylpyrylium chloride (PubChem CID 2734003) has the molecular formula C23H17ClO and a molecular weight of 344.84 g/mol. Its IUPAC name is 2,4,6-triphenylpyrylium chloride.
| Compound Name | 2,4,6-triphenylpyrylium chloride |
|---|---|
| PubChem CID | 2734003 |
| Molecular Formula | C23H17ClO |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2,4,6-triphenylpyrylium chloride |
| SMILES | [Cl-].c1ccc(-c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H17O.ClH/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20;/h1-17H;1H/q+1;/p-1 |
| InChIKey | HBOJAJCANMJVFP-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|