About (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol
(2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol (PubChem CID 2734021) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol.
Molecular Properties
| Compound Name | (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol |
| PubChem CID | 2734021 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol |
| SMILES | CC1=C[C@H](O)C2CC1C2(C)C |
| InChI | InChI=1S/C10H16O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-9,11H,5H2,1-3H3/t7?,8?,9-/m0/s1 |
| InChIKey | WONIGEXYPVIKFS-HACHORDNSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol?
The IUPAC name of (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol (CID 2734021) is (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol.
What is the SMILES notation for (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol?
The canonical SMILES for (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol is CC1=C[C@H](O)C2CC1C2(C)C.
What is the InChIKey of (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol?
The InChIKey is WONIGEXYPVIKFS-HACHORDNSA-N. The full InChI is InChI=1S/C10H16O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-9,11H,5H2,1-3H3/t7?,8?,9-/m0/s1.
What are the key properties of (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol?
(2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol has a molecular weight of 152.24 g/mol, XLogP of 1.97, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol is sourced from PubChem (CID 2734021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).