About 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium
4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium (PubChem CID 2734060) has the molecular formula C10H17N4O3+
and a molecular weight of 241.27 g/mol. Its IUPAC name is 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium.
Molecular Properties
| Compound Name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium |
| PubChem CID | 2734060 |
| Molecular Formula | C10H17N4O3+ |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium |
| SMILES | COc1nc(OC)nc([N+]2(C)CCOCC2)n1 |
| InChI | InChI=1S/C10H17N4O3/c1-14(4-6-17-7-5-14)8-11-9(15-2)13-10(12-8)16-3/h4-7H2,1-3H3/q+1 |
| InChIKey | NZBKIOJQXNGENQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium?
The IUPAC name of 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium (CID 2734060) is 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium.
What is the SMILES notation for 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium?
The canonical SMILES for 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium is COc1nc(OC)nc([N+]2(C)CCOCC2)n1.
What is the InChIKey of 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium?
The InChIKey is NZBKIOJQXNGENQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N4O3/c1-14(4-6-17-7-5-14)8-11-9(15-2)13-10(12-8)16-3/h4-7H2,1-3H3/q+1.
What are the key properties of 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium?
4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium has a molecular weight of 241.27 g/mol, XLogP of -0.14, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium is sourced from PubChem (CID 2734060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).