About 2-amino-3,5-dibromobenzonitrile
2-amino-3,5-dibromobenzonitrile (PubChem CID 2734082) has the molecular formula C7H4Br2N2
and a molecular weight of 275.93 g/mol. Its IUPAC name is 2-amino-3,5-dibromobenzonitrile.
Molecular Properties
| Compound Name | 2-amino-3,5-dibromobenzonitrile |
| PubChem CID | 2734082 |
| Molecular Formula | C7H4Br2N2 |
| Molecular Weight | 275.93 g/mol |
| Exact Mass | 273.87 |
| IUPAC Name | 2-amino-3,5-dibromobenzonitrile |
| SMILES | N#Cc1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C7H4Br2N2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2H,11H2 |
| InChIKey | WLZCMGXAEXFAQA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.93 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,5-dibromobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,5-dibromobenzonitrile?
The IUPAC name of 2-amino-3,5-dibromobenzonitrile (CID 2734082) is 2-amino-3,5-dibromobenzonitrile.
What is the SMILES notation for 2-amino-3,5-dibromobenzonitrile?
The canonical SMILES for 2-amino-3,5-dibromobenzonitrile is N#Cc1cc(Br)cc(Br)c1N.
What is the InChIKey of 2-amino-3,5-dibromobenzonitrile?
The InChIKey is WLZCMGXAEXFAQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Br2N2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2H,11H2.
What are the key properties of 2-amino-3,5-dibromobenzonitrile?
2-amino-3,5-dibromobenzonitrile has a molecular weight of 275.93 g/mol, XLogP of 2.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,5-dibromobenzonitrile is sourced from PubChem (CID 2734082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).