About methyl 2-(2,4-dichlorophenyl)acetate
methyl 2-(2,4-dichlorophenyl)acetate (PubChem CID 2734106) has the molecular formula C9H8Cl2O2
and a molecular weight of 219.07 g/mol. Its IUPAC name is methyl 2-(2,4-dichlorophenyl)acetate.
Molecular Properties
| Compound Name | methyl 2-(2,4-dichlorophenyl)acetate |
| PubChem CID | 2734106 |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | methyl 2-(2,4-dichlorophenyl)acetate |
| SMILES | COC(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2O2/c1-13-9(12)4-6-2-3-7(10)5-8(6)11/h2-3,5H,4H2,1H3 |
| InChIKey | SRCVNBFTEARRJY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-(2,4-dichlorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,4-dichlorophenyl)acetate?
The IUPAC name of methyl 2-(2,4-dichlorophenyl)acetate (CID 2734106) is methyl 2-(2,4-dichlorophenyl)acetate.
What is the SMILES notation for methyl 2-(2,4-dichlorophenyl)acetate?
The canonical SMILES for methyl 2-(2,4-dichlorophenyl)acetate is COC(=O)Cc1ccc(Cl)cc1Cl.
What is the InChIKey of methyl 2-(2,4-dichlorophenyl)acetate?
The InChIKey is SRCVNBFTEARRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2O2/c1-13-9(12)4-6-2-3-7(10)5-8(6)11/h2-3,5H,4H2,1H3.
What are the key properties of methyl 2-(2,4-dichlorophenyl)acetate?
methyl 2-(2,4-dichlorophenyl)acetate has a molecular weight of 219.07 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,4-dichlorophenyl)acetate is sourced from PubChem (CID 2734106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).