About tetraoctylazanium bromide
tetraoctylazanium bromide (PubChem CID 2734117) has the molecular formula C32H68BrN
and a molecular weight of 546.81 g/mol. Its IUPAC name is tetraoctylazanium bromide.
Molecular Properties
| Compound Name | tetraoctylazanium bromide |
| PubChem CID | 2734117 |
| Molecular Formula | C32H68BrN |
| Molecular Weight | 546.81 g/mol |
| Exact Mass | 545.45 |
| IUPAC Name | tetraoctylazanium bromide |
| SMILES | CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.[Br-] |
| InChI | InChI=1S/C32H68N.BrH/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;/h5-32H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | QBVXKDJEZKEASM-UHFFFAOYSA-M |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 28 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.81 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetraoctylazanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraoctylazanium bromide?
The IUPAC name of tetraoctylazanium bromide (CID 2734117) is tetraoctylazanium bromide.
What is the SMILES notation for tetraoctylazanium bromide?
The canonical SMILES for tetraoctylazanium bromide is CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.[Br-].
What is the InChIKey of tetraoctylazanium bromide?
The InChIKey is QBVXKDJEZKEASM-UHFFFAOYSA-M. The full InChI is InChI=1S/C32H68N.BrH/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;/h5-32H2,1-4H3;1H/q+1;/p-1.
What are the key properties of tetraoctylazanium bromide?
tetraoctylazanium bromide has a molecular weight of 546.81 g/mol, XLogP of 8.25, 28 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetraoctylazanium bromide is sourced from PubChem (CID 2734117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).